C26H27N3O3S2 — CID 5176556
N-[6-(dipropylsulfamoyl)-1,3-benzothiazol-2-yl]-4-phenylbenzamide (PubChem CID 5176556) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[6-(dipropylsulfamoyl)-1,3-benzothiazol-2-yl]-4-phenylbenzamide.
| Compound Name | N-[6-(dipropylsulfamoyl)-1,3-benzothiazol-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 5176556 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[6-(dipropylsulfamoyl)-1,3-benzothiazol-2-yl]-4-phenylbenzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc2nc(NC(=O)c3ccc(-c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C26H27N3O3S2/c1-3-16-29(17-4-2)34(31,32)22-14-15-23-24(18-22)33-26(27-23)28-25(30)21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-15,18H,3-4,16-17H2,1-2H3,(H,27,28,30) |
| InChIKey | MONWLWHFWLKXKN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |