C20H23N3O3S2 — CID 35983232
5-(diethylsulfamoyl)-2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 35983232) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 35983232 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)Nc2nc3ccc(C)cc3s2)c1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-5-23(6-2)28(25,26)15-9-8-14(4)16(12-15)19(24)22-20-21-17-10-7-13(3)11-18(17)27-20/h7-12H,5-6H2,1-4H3,(H,21,22,24) |
| InChIKey | JPBMUDJFOKZOLT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |