C20H23N3O4S2 — CID 46813269
5-(diethylsulfamoyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzamide (PubChem CID 46813269) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 46813269 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)Nc2nc3c(OC)cccc3s2)c1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-5-23(6-2)29(25,26)14-11-10-13(3)15(12-14)19(24)22-20-21-18-16(27-4)8-7-9-17(18)28-20/h7-12H,5-6H2,1-4H3,(H,21,22,24) |
| InChIKey | RXZPWJBZRMUJCZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |