C18H18N2O2S — CID 3344551
N-(4-ethoxy-1,3-benzothiazol-2-yl)-2,5-dimethylbenzamide (PubChem CID 3344551) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-2,5-dimethylbenzamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 3344551 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-2,5-dimethylbenzamide |
| SMILES | CCOc1cccc2sc(NC(=O)c3cc(C)ccc3C)nc12 |
| InChI | InChI=1S/C18H18N2O2S/c1-4-22-14-6-5-7-15-16(14)19-18(23-15)20-17(21)13-10-11(2)8-9-12(13)3/h5-10H,4H2,1-3H3,(H,19,20,21) |
| InChIKey | RWHSKHLKDIMXLS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |