C14H12N2O2S2 — CID 958996
N-(4-ethoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 958996) has the molecular formula C14H12N2O2S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 958996 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCOc1cccc2sc(NC(=O)c3cccs3)nc12 |
| InChI | InChI=1S/C14H12N2O2S2/c1-2-18-9-5-3-6-10-12(9)15-14(20-10)16-13(17)11-7-4-8-19-11/h3-8H,2H2,1H3,(H,15,16,17) |
| InChIKey | IRLLWNWVBDMAIB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |