C15H13ClN2O2S2 — CID 41340393
2-(5-chlorothiophen-2-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41340393) has the molecular formula C15H13ClN2O2S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41340393 |
| Molecular Formula | C15H13ClN2O2S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCOc1cccc2sc(NC(=O)Cc3ccc(Cl)s3)nc12 |
| InChI | InChI=1S/C15H13ClN2O2S2/c1-2-20-10-4-3-5-11-14(10)18-15(22-11)17-13(19)8-9-6-7-12(16)21-9/h3-7H,2,8H2,1H3,(H,17,18,19) |
| InChIKey | RVUUNYMOYKXKDH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |