C20H22N2O3S — CID 19214376
N-(4-ethoxy-1,3-benzothiazol-2-yl)-2-(4-propylphenoxy)acetamide (PubChem CID 19214376) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-2-(4-propylphenoxy)acetamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-2-(4-propylphenoxy)acetamide |
|---|---|
| PubChem CID | 19214376 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-2-(4-propylphenoxy)acetamide |
| SMILES | CCCc1ccc(OCC(=O)Nc2nc3c(OCC)cccc3s2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-6-14-9-11-15(12-10-14)25-13-18(23)21-20-22-19-16(24-4-2)7-5-8-17(19)26-20/h5,7-12H,3-4,6,13H2,1-2H3,(H,21,22,23) |
| InChIKey | DGLYVXQCZRURAW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |