C17H15ClN2O3S — CID 19214384
2-(2-chlorophenoxy)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 19214384) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19214384 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(4-ethoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCOc1cccc2sc(NC(=O)COc3ccccc3Cl)nc12 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-2-22-13-8-5-9-14-16(13)20-17(24-14)19-15(21)10-23-12-7-4-3-6-11(12)18/h3-9H,2,10H2,1H3,(H,19,20,21) |
| InChIKey | SNSFLSBJJRKAET-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |