C17H15ClN2O2S — CID 17100966
2-(2-chlorophenoxy)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 17100966) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17100966 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1ccc(C)c2sc(NC(=O)COc3ccccc3Cl)nc12 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-10-7-8-11(2)16-15(10)20-17(23-16)19-14(21)9-22-13-6-4-3-5-12(13)18/h3-8H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | ZHTGLNKZDUSEGI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |