C22H18Cl2N2O4 — CID 1032604
2-(2-chlorophenoxy)-N-[2-[[2-(2-chlorophenoxy)acetyl]amino]phenyl]acetamide (PubChem CID 1032604) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-[[2-(2-chlorophenoxy)acetyl]amino]phenyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-[[2-(2-chlorophenoxy)acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 1032604 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-[[2-(2-chlorophenoxy)acetyl]amino]phenyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1ccccc1NC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O4/c23-15-7-1-5-11-19(15)29-13-21(27)25-17-9-3-4-10-18(17)26-22(28)14-30-20-12-6-2-8-16(20)24/h1-12H,13-14H2,(H,25,27)(H,26,28) |
| InChIKey | APAWXXLENGSAGW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |