C8H8ClNO3 — CID 95562486
2-(2-chlorophenoxy)-N-hydroxyacetamide (PubChem CID 95562486) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-hydroxyacetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 95562486 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-hydroxyacetamide |
| SMILES | O=C(COc1ccccc1Cl)NO |
| InChI | InChI=1S/C8H8ClNO3/c9-6-3-1-2-4-7(6)13-5-8(11)10-12/h1-4,12H,5H2,(H,10,11) |
| InChIKey | OJFQYWJSQVDTIE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|