C16H13BrN2O2S — CID 3431686
2-bromo-N-(4-ethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 3431686) has the molecular formula C16H13BrN2O2S and a molecular weight of 377.26 g/mol. Its IUPAC name is 2-bromo-N-(4-ethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-bromo-N-(4-ethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 3431686 |
| Molecular Formula | C16H13BrN2O2S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 2-bromo-N-(4-ethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1cccc2sc(NC(=O)c3ccccc3Br)nc12 |
| InChI | InChI=1S/C16H13BrN2O2S/c1-2-21-12-8-5-9-13-14(12)18-16(22-13)19-15(20)10-6-3-4-7-11(10)17/h3-9H,2H2,1H3,(H,18,19,20) |
| InChIKey | JWLIXYWMCXVRSD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |