C15H11BrN2OS2 — CID 7615172
2-bromo-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7615172) has the molecular formula C15H11BrN2OS2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 2-bromo-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-bromo-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7615172 |
| Molecular Formula | C15H11BrN2OS2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 2-bromo-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CSc1cccc2sc(NC(=O)c3ccccc3Br)nc12 |
| InChI | InChI=1S/C15H11BrN2OS2/c1-20-11-7-4-8-12-13(11)17-15(21-12)18-14(19)9-5-2-3-6-10(9)16/h2-8H,1H3,(H,17,18,19) |
| InChIKey | FLSNFTNUQFYDMM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |