C18H12N2O3S2 — CID 7615195
N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 7615195) has the molecular formula C18H12N2O3S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7615195 |
| Molecular Formula | C18H12N2O3S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | CSc1cccc2sc(NC(=O)c3cc4ccccc4oc3=O)nc12 |
| InChI | InChI=1S/C18H12N2O3S2/c1-24-13-7-4-8-14-15(13)19-18(25-14)20-16(21)11-9-10-5-2-3-6-12(10)23-17(11)22/h2-9H,1H3,(H,19,20,21) |
| InChIKey | DVTVMPRKXREHFM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|