C17H9ClN2O3S — CID 1144036
N-(6-chloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 1144036) has the molecular formula C17H9ClN2O3S and a molecular weight of 356.79 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1144036 |
| Molecular Formula | C17H9ClN2O3S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H9ClN2O3S/c18-10-5-6-12-14(8-10)24-17(19-12)20-15(21)11-7-9-3-1-2-4-13(9)23-16(11)22/h1-8H,(H,19,20,21) |
| InChIKey | BZHBRRVSGWAKIM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|