C22H12Cl2N4O2S2 — CID 4651435
1-N,2-N-bis(6-chloro-1,3-benzothiazol-2-yl)benzene-1,2-dicarboxamide (PubChem CID 4651435) has the molecular formula C22H12Cl2N4O2S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 1-N,2-N-bis(6-chloro-1,3-benzothiazol-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-bis(6-chloro-1,3-benzothiazol-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 4651435 |
| Molecular Formula | C22H12Cl2N4O2S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 1-N,2-N-bis(6-chloro-1,3-benzothiazol-2-yl)benzene-1,2-dicarboxamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1ccccc1C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C22H12Cl2N4O2S2/c23-11-5-7-15-17(9-11)31-21(25-15)27-19(29)13-3-1-2-4-14(13)20(30)28-22-26-16-8-6-12(24)10-18(16)32-22/h1-10H,(H,25,27,29)(H,26,28,30) |
| InChIKey | VYFBQZMPXPQVQG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |