C14H4ClF5N2OS — CID 5136272
N-(6-chloro-1,3-benzothiazol-2-yl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 5136272) has the molecular formula C14H4ClF5N2OS and a molecular weight of 378.71 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 5136272 |
| Molecular Formula | C14H4ClF5N2OS |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H4ClF5N2OS/c15-4-1-2-5-6(3-4)24-14(21-5)22-13(23)7-8(16)10(18)12(20)11(19)9(7)17/h1-3H,(H,21,22,23) |
| InChIKey | GLWVTWKCOIBXAD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|