C9H4ClF3N2OS — CID 4099366
N-(6-chloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 4099366) has the molecular formula C9H4ClF3N2OS and a molecular weight of 280.66 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 4099366 |
| Molecular Formula | C9H4ClF3N2OS |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)C(F)(F)F |
| InChI | InChI=1S/C9H4ClF3N2OS/c10-4-1-2-5-6(3-4)17-8(14-5)15-7(16)9(11,12)13/h1-3H,(H,14,15,16) |
| InChIKey | UUCZMFLHBYBRHN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |