C12H14ClN3OS — CID 79790796
2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-methylbutanamide (PubChem CID 79790796) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-methylbutanamide.
| Compound Name | 2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 79790796 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)(N)C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-3-12(2,14)10(17)16-11-15-8-5-4-7(13)6-9(8)18-11/h4-6H,3,14H2,1-2H3,(H,15,16,17) |
| InChIKey | XOUUEEXJPPJFBM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |