C13H11ClN2O3S — CID 54783242
ethyl (E)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoate (PubChem CID 54783242) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is ethyl (E)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 54783242 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | ethyl (E)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H11ClN2O3S/c1-2-19-12(18)6-5-11(17)16-13-15-9-4-3-8(14)7-10(9)20-13/h3-7H,2H2,1H3,(H,15,16,17)/b6-5+ |
| InChIKey | UZTBAWTWSMJION-AATRIKPKSA-N |
| XLogP | 3.01 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|