C16H21ClN2O2S — CID 108739106
2-ethylhexyl N-(6-chloro-1,3-benzothiazol-2-yl)carbamate (PubChem CID 108739106) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 2-ethylhexyl N-(6-chloro-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | 2-ethylhexyl N-(6-chloro-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 108739106 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-ethylhexyl N-(6-chloro-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CCCCC(CC)COC(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C16H21ClN2O2S/c1-3-5-6-11(4-2)10-21-16(20)19-15-18-13-8-7-12(17)9-14(13)22-15/h7-9,11H,3-6,10H2,1-2H3,(H,18,19,20) |
| InChIKey | PMYAVGOEEBXNPY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |