C13H16ClN3OS — CID 107143831
(2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 107143831) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 107143831 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | CCCC[C@H](N)C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-2-3-4-9(15)12(18)17-13-16-10-6-5-8(14)7-11(10)19-13/h5-7,9H,2-4,15H2,1H3,(H,16,17,18)/t9-/m0/s1 |
| InChIKey | QCCIMTCLBZBZKY-VIFPVBQESA-N |
| XLogP | 3.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |