C16H13ClN2OS2 — CID 169288590
N-(6-chloro-1,3-benzothiazol-2-yl)-3-phenyl-2-sulfanylpropanamide (PubChem CID 169288590) has the molecular formula C16H13ClN2OS2 and a molecular weight of 348.88 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 169288590 |
| Molecular Formula | C16H13ClN2OS2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-phenyl-2-sulfanylpropanamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C16H13ClN2OS2/c17-11-6-7-12-14(9-11)22-16(18-12)19-15(20)13(21)8-10-4-2-1-3-5-10/h1-7,9,13,21H,8H2,(H,18,19,20) |
| InChIKey | QSUCZYKGZZJJEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|