C15H11ClN2OS2 — CID 107020051
N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107020051) has the molecular formula C15H11ClN2OS2 and a molecular weight of 334.85 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107020051 |
| Molecular Formula | C15H11ClN2OS2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S)cc1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C15H11ClN2OS2/c16-10-3-6-12-13(8-10)21-15(17-12)18-14(19)7-9-1-4-11(20)5-2-9/h1-6,8,20H,7H2,(H,17,18,19) |
| InChIKey | MJVCPLREVFCNJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|