C16H13ClN2O2S — CID 708592
2-(4-chlorophenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 708592) has the molecular formula C16H13ClN2O2S and a molecular weight of 332.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 708592 |
| Molecular Formula | C16H13ClN2O2S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc2nc(NC(=O)Cc3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C16H13ClN2O2S/c1-21-12-6-7-13-14(9-12)22-16(18-13)19-15(20)8-10-2-4-11(17)5-3-10/h2-7,9H,8H2,1H3,(H,18,19,20) |
| InChIKey | GNVAANUCTNCRME-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |