C12H14N2O3S — CID 2163146
2-ethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 2163146) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-ethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-ethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2163146 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-ethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCOCC(=O)Nc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-17-7-11(15)14-12-13-9-5-4-8(16-2)6-10(9)18-12/h4-6H,3,7H2,1-2H3,(H,13,14,15) |
| InChIKey | GDICFSYPOCKURC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |