C17H13N3O3S — CID 35727768
2-(4-cyanophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 35727768) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 35727768 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc2nc(NC(=O)COc3ccc(C#N)cc3)sc2c1 |
| InChI | InChI=1S/C17H13N3O3S/c1-22-13-6-7-14-15(8-13)24-17(19-14)20-16(21)10-23-12-4-2-11(9-18)3-5-12/h2-8H,10H2,1H3,(H,19,20,21) |
| InChIKey | SWCXSUFYYSNRAB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |