C12H15N3O2S — CID 54924268
3-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide (PubChem CID 54924268) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 3-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 54924268 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-amino-N-(6-methoxy-1,3-benzothiazol-2-yl)butanamide |
| SMILES | COc1ccc2nc(NC(=O)CC(C)N)sc2c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-7(13)5-11(16)15-12-14-9-4-3-8(17-2)6-10(9)18-12/h3-4,6-7H,5,13H2,1-2H3,(H,14,15,16) |
| InChIKey | OMOVVBYFDGZBGA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |