C13H17N3O2S — CID 60835509
3-amino-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide (PubChem CID 60835509) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-amino-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 3-amino-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 60835509 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-amino-N-(6-ethoxy-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCOc1ccc2nc(NC(=O)CC(C)N)sc2c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-18-9-4-5-10-11(7-9)19-13(15-10)16-12(17)6-8(2)14/h4-5,7-8H,3,6,14H2,1-2H3,(H,15,16,17) |
| InChIKey | CYLKGJJWTPPELK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |