C14H18N2O2S — CID 884256
(2S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpentanamide (PubChem CID 884256) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (2S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpentanamide.
| Compound Name | (2S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpentanamide |
|---|---|
| PubChem CID | 884256 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpentanamide |
| SMILES | CCC[C@H](C)C(=O)Nc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-4-5-9(2)13(17)16-14-15-11-7-6-10(18-3)8-12(11)19-14/h6-9H,4-5H2,1-3H3,(H,15,16,17)/t9-/m0/s1 |
| InChIKey | SRNLPPAWUMYVLS-VIFPVBQESA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |