C18H18N2O2S — CID 845796
(2R)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylbutanamide (PubChem CID 845796) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2R)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylbutanamide.
| Compound Name | (2R)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 845796 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2R)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)Nc1nc2ccc(OC)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-3-14(12-7-5-4-6-8-12)17(21)20-18-19-15-10-9-13(22-2)11-16(15)23-18/h4-11,14H,3H2,1-2H3,(H,19,20,21)/t14-/m1/s1 |
| InChIKey | QPUNPERLMNHKEY-CQSZACIVSA-N |
| XLogP | 4.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |