C11H12N2O2S2 — CID 107020679
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-sulfanylpropanamide (PubChem CID 107020679) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-sulfanylpropanamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107020679 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-sulfanylpropanamide |
| SMILES | COc1ccc2nc(NC(=O)C(C)S)sc2c1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-6(16)10(14)13-11-12-8-4-3-7(15-2)5-9(8)17-11/h3-6,16H,1-2H3,(H,12,13,14) |
| InChIKey | GNRMNTWFDIPRHL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|