C12H12ClN3O3S — CID 43328820
2-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]propanamide (PubChem CID 43328820) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 2-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 43328820 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-chloro-N-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]propanamide |
| SMILES | COc1ccc2nc(NC(=O)NC(=O)C(C)Cl)sc2c1 |
| InChI | InChI=1S/C12H12ClN3O3S/c1-6(13)10(17)15-11(18)16-12-14-8-4-3-7(19-2)5-9(8)20-12/h3-6H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | XXJPKXJQTPRXDF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|