C11H13N3O3S — CID 110676070
1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(methoxymethyl)urea (PubChem CID 110676070) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(methoxymethyl)urea.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(methoxymethyl)urea |
|---|---|
| PubChem CID | 110676070 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-(methoxymethyl)urea |
| SMILES | COCNC(=O)Nc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C11H13N3O3S/c1-16-6-12-10(15)14-11-13-8-4-3-7(17-2)5-9(8)18-11/h3-5H,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | ZOQDLSYHTVFFCS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|