C13H11N3O2S2 — CID 20885064
1-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea (PubChem CID 20885064) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 20885064 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
| SMILES | COc1ccc2nc(NC(=O)Nc3cccs3)sc2c1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-18-8-4-5-9-10(7-8)20-13(14-9)16-12(17)15-11-3-2-6-19-11/h2-7H,1H3,(H2,14,15,16,17) |
| InChIKey | CLOWGSDPLQPREB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |