C19H14IN2O2S2+ — CID 87394436
[3-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium (PubChem CID 87394436) has the molecular formula C19H14IN2O2S2+ and a molecular weight of 493.37 g/mol. Its IUPAC name is [3-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium.
| Compound Name | [3-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium |
|---|---|
| PubChem CID | 87394436 |
| Molecular Formula | C19H14IN2O2S2+ |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | [3-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium |
| SMILES | COc1ccc2nc(NC(=O)c3cccc([I+]c4cccs4)c3)sc2c1 |
| InChI | InChI=1S/C19H13IN2O2S2/c1-24-14-7-8-15-16(11-14)26-19(21-15)22-18(23)12-4-2-5-13(10-12)20-17-6-3-9-25-17/h2-11H,1H3/p+1 |
| InChIKey | ZRVROVRTSWERFJ-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|