C19H14ClIN2O6S2 — CID 87393973
[4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium perchlorate (PubChem CID 87393973) has the molecular formula C19H14ClIN2O6S2 and a molecular weight of 592.82 g/mol. Its IUPAC name is [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium perchlorate.
| Compound Name | [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium perchlorate |
|---|---|
| PubChem CID | 87393973 |
| Molecular Formula | C19H14ClIN2O6S2 |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 591.90 |
| IUPAC Name | [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-thiophen-2-yliodanium perchlorate |
| SMILES | COc1ccc2nc(NC(=O)c3ccc([I+]c4cccs4)cc3)sc2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H13IN2O2S2.ClHO4/c1-24-14-8-9-15-16(11-14)26-19(21-15)22-18(23)12-4-6-13(7-5-12)20-17-3-2-10-25-17;2-1(3,4)5/h2-11H,1H3;(H,2,3,4,5) |
| InChIKey | KJXZHUHTBSIGEO-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|