C29H25IN2O5S2 — CID 159122678
[4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-(3-methylphenyl)iodanium;4-methylbenzenesulfonate (PubChem CID 159122678) has the molecular formula C29H25IN2O5S2 and a molecular weight of 672.57 g/mol. Its IUPAC name is [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-(3-methylphenyl)iodanium;4-methylbenzenesulfonate.
| Compound Name | [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-(3-methylphenyl)iodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159122678 |
| Molecular Formula | C29H25IN2O5S2 |
| Molecular Weight | 672.57 g/mol |
| Exact Mass | 672.02 |
| IUPAC Name | [4-[(6-methoxy-1,3-benzothiazol-2-yl)carbamoyl]phenyl]-(3-methylphenyl)iodanium;4-methylbenzenesulfonate |
| SMILES | COc1ccc2nc(NC(=O)c3ccc([I+]c4cccc(C)c4)cc3)sc2c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C22H17IN2O2S.C7H8O3S/c1-14-4-3-5-17(12-14)23-16-8-6-15(7-9-16)21(26)25-22-24-19-11-10-18(27-2)13-20(19)28-22;1-6-2-4-7(5-3-6)11(8,9)10/h3-13H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | KFWVYCANPFOEDL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|