C15H12BrN3O2S — CID 35279656
1-(6-bromo-1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)urea (PubChem CID 35279656) has the molecular formula C15H12BrN3O2S and a molecular weight of 378.25 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-(6-bromo-1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 35279656 |
| Molecular Formula | C15H12BrN3O2S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 1-(6-bromo-1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C15H12BrN3O2S/c1-21-11-5-3-10(4-6-11)17-14(20)19-15-18-12-7-2-9(16)8-13(12)22-15/h2-8H,1H3,(H2,17,18,19,20) |
| InChIKey | RTOZDUHTLYICCM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |