C12H12Br2N2OS — CID 28663164
(2S)-2-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-3-methylbutanamide (PubChem CID 28663164) has the molecular formula C12H12Br2N2OS and a molecular weight of 392.12 g/mol. Its IUPAC name is (2S)-2-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-3-methylbutanamide.
| Compound Name | (2S)-2-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 28663164 |
| Molecular Formula | C12H12Br2N2OS |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | (2S)-2-bromo-N-(6-bromo-1,3-benzothiazol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](Br)C(=O)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C12H12Br2N2OS/c1-6(2)10(14)11(17)16-12-15-8-4-3-7(13)5-9(8)18-12/h3-6,10H,1-2H3,(H,15,16,17)/t10-/m0/s1 |
| InChIKey | YSFSLHZPMZAEGX-JTQLQIEISA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|