C12H14BrN3OS — CID 106346324
2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide (PubChem CID 106346324) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106346324 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1nc2ccc(Br)cc2s1)C(N)=O |
| InChI | InChI=1S/C12H14BrN3OS/c1-6(2)10(11(14)17)16-12-15-8-4-3-7(13)5-9(8)18-12/h3-6,10H,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | FVSHJNNUMRZONY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |