C14H19BrN2S — CID 114101102
6-bromo-N-(2,2,3-trimethylbutyl)-1,3-benzothiazol-2-amine (PubChem CID 114101102) has the molecular formula C14H19BrN2S and a molecular weight of 327.29 g/mol. Its IUPAC name is 6-bromo-N-(2,2,3-trimethylbutyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(2,2,3-trimethylbutyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114101102 |
| Molecular Formula | C14H19BrN2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 6-bromo-N-(2,2,3-trimethylbutyl)-1,3-benzothiazol-2-amine |
| SMILES | CC(C)C(C)(C)CNc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C14H19BrN2S/c1-9(2)14(3,4)8-16-13-17-11-6-5-10(15)7-12(11)18-13/h5-7,9H,8H2,1-4H3,(H,16,17) |
| InChIKey | HYTJMNKOVZJDGU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |