C15H21BrN2S — CID 115569155
6-bromo-N-octyl-1,3-benzothiazol-2-amine (PubChem CID 115569155) has the molecular formula C15H21BrN2S and a molecular weight of 341.32 g/mol. Its IUPAC name is 6-bromo-N-octyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-octyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 115569155 |
| Molecular Formula | C15H21BrN2S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 6-bromo-N-octyl-1,3-benzothiazol-2-amine |
| SMILES | CCCCCCCCNc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C15H21BrN2S/c1-2-3-4-5-6-7-10-17-15-18-13-9-8-12(16)11-14(13)19-15/h8-9,11H,2-7,10H2,1H3,(H,17,18) |
| InChIKey | MKJKHUXVFUMDKD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|