C13H18N2S — CID 79142327
6-methyl-N-pentyl-1,3-benzothiazol-2-amine (PubChem CID 79142327) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 6-methyl-N-pentyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-methyl-N-pentyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79142327 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 6-methyl-N-pentyl-1,3-benzothiazol-2-amine |
| SMILES | CCCCCNc1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C13H18N2S/c1-3-4-5-8-14-13-15-11-7-6-10(2)9-12(11)16-13/h6-7,9H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | YTRANMSJAALRDV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|