C11H13BrN2O2S — CID 166270828
2-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethoxy]ethanol (PubChem CID 166270828) has the molecular formula C11H13BrN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is 2-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 166270828 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C11H13BrN2O2S/c12-8-1-2-9-10(7-8)17-11(14-9)13-3-5-16-6-4-15/h1-2,7,15H,3-6H2,(H,13,14) |
| InChIKey | DTTOAAUVPURBHW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|