C10H8BrF3N2S2 — CID 114188125
6-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-benzothiazol-2-amine (PubChem CID 114188125) has the molecular formula C10H8BrF3N2S2 and a molecular weight of 357.22 g/mol. Its IUPAC name is 6-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114188125 |
| Molecular Formula | C10H8BrF3N2S2 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 6-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)SCCNc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C10H8BrF3N2S2/c11-6-1-2-7-8(5-6)18-9(16-7)15-3-4-17-10(12,13)14/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | YFGCLMFQNFSEAL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|