C11H10BrF3N2S — CID 115520932
5-bromo-N-(4,4,4-trifluorobutyl)-1,3-benzothiazol-2-amine (PubChem CID 115520932) has the molecular formula C11H10BrF3N2S and a molecular weight of 339.18 g/mol. Its IUPAC name is 5-bromo-N-(4,4,4-trifluorobutyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-bromo-N-(4,4,4-trifluorobutyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 115520932 |
| Molecular Formula | C11H10BrF3N2S |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 5-bromo-N-(4,4,4-trifluorobutyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)CCCNc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C11H10BrF3N2S/c12-7-2-3-9-8(6-7)17-10(18-9)16-5-1-4-11(13,14)15/h2-3,6H,1,4-5H2,(H,16,17) |
| InChIKey | LQCODWGCXLFECO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|