C11H11BrN2O2S — CID 61295192
methyl 3-[(5-bromo-1,3-benzothiazol-2-yl)amino]propanoate (PubChem CID 61295192) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is methyl 3-[(5-bromo-1,3-benzothiazol-2-yl)amino]propanoate.
| Compound Name | methyl 3-[(5-bromo-1,3-benzothiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 61295192 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | methyl 3-[(5-bromo-1,3-benzothiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C11H11BrN2O2S/c1-16-10(15)4-5-13-11-14-8-6-7(12)2-3-9(8)17-11/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | HEKRNOVXWZFRGL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |