C10H8BrF3N2S — CID 63227279
5-bromo-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-2-amine (PubChem CID 63227279) has the molecular formula C10H8BrF3N2S and a molecular weight of 325.15 g/mol. Its IUPAC name is 5-bromo-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-bromo-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 63227279 |
| Molecular Formula | C10H8BrF3N2S |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 5-bromo-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)CCNc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C10H8BrF3N2S/c11-6-1-2-8-7(5-6)16-9(17-8)15-4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | RZGIIWLSOBUACF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |