C10H11BrN4OS — CID 83115580
2-[(5-bromo-1,3-benzothiazol-2-yl)amino]ethylurea (PubChem CID 83115580) has the molecular formula C10H11BrN4OS and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-[(5-bromo-1,3-benzothiazol-2-yl)amino]ethylurea.
| Compound Name | 2-[(5-bromo-1,3-benzothiazol-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83115580 |
| Molecular Formula | C10H11BrN4OS |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-[(5-bromo-1,3-benzothiazol-2-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C10H11BrN4OS/c11-6-1-2-8-7(5-6)15-10(17-8)14-4-3-13-9(12)16/h1-2,5H,3-4H2,(H,14,15)(H3,12,13,16) |
| InChIKey | ZLKPFVSOQSNANN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|